C16H22N2O4S — CID 78821733
2-(3-acetylanilino)-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide (PubChem CID 78821733) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is 2-(3-acetylanilino)-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide.
| Compound Name | 2-(3-acetylanilino)-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide |
|---|---|
| PubChem CID | 78821733 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-(3-acetylanilino)-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide |
| SMILES | CCN(C(=O)CNc1cccc(C(C)=O)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H22N2O4S/c1-3-18(15-7-8-23(21,22)11-15)16(20)10-17-14-6-4-5-13(9-14)12(2)19/h4-6,9,15,17H,3,7-8,10-11H2,1-2H3 |
| InChIKey | WIQXXVFUIANZCP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |