C16H20N2O5S — CID 113165079
2-[acetyl-(1,1-dioxothiolan-3-yl)amino]-N-(3-acetylphenyl)acetamide (PubChem CID 113165079) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is 2-[acetyl-(1,1-dioxothiolan-3-yl)amino]-N-(3-acetylphenyl)acetamide.
| Compound Name | 2-[acetyl-(1,1-dioxothiolan-3-yl)amino]-N-(3-acetylphenyl)acetamide |
|---|---|
| PubChem CID | 113165079 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-[acetyl-(1,1-dioxothiolan-3-yl)amino]-N-(3-acetylphenyl)acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CN(C(C)=O)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C16H20N2O5S/c1-11(19)13-4-3-5-14(8-13)17-16(21)9-18(12(2)20)15-6-7-24(22,23)10-15/h3-5,8,15H,6-7,9-10H2,1-2H3,(H,17,21) |
| InChIKey | NGOAULVRVQZOFE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |