C15H19NO4S — CID 110861049
N-(3-acetylphenyl)-2-(1,1-dioxothian-4-yl)acetamide (PubChem CID 110861049) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-(1,1-dioxothian-4-yl)acetamide.
| Compound Name | N-(3-acetylphenyl)-2-(1,1-dioxothian-4-yl)acetamide |
|---|---|
| PubChem CID | 110861049 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | N-(3-acetylphenyl)-2-(1,1-dioxothian-4-yl)acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CC2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C15H19NO4S/c1-11(17)13-3-2-4-14(10-13)16-15(18)9-12-5-7-21(19,20)8-6-12/h2-4,10,12H,5-9H2,1H3,(H,16,18) |
| InChIKey | IPXXPIIGQGZMNT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |