C14H18N2O4S — CID 60546387
N-(3-acetylphenyl)-2-(1,1-dioxo-1,4-thiazinan-4-yl)acetamide (PubChem CID 60546387) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-(1,1-dioxo-1,4-thiazinan-4-yl)acetamide.
| Compound Name | N-(3-acetylphenyl)-2-(1,1-dioxo-1,4-thiazinan-4-yl)acetamide |
|---|---|
| PubChem CID | 60546387 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-(3-acetylphenyl)-2-(1,1-dioxo-1,4-thiazinan-4-yl)acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CN2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C14H18N2O4S/c1-11(17)12-3-2-4-13(9-12)15-14(18)10-16-5-7-21(19,20)8-6-16/h2-4,9H,5-8,10H2,1H3,(H,15,18) |
| InChIKey | CSEOONPJMCQHKE-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |