C14H18N2O4S — CID 80518042
N-(3-acetylphenyl)-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide (PubChem CID 80518042) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide.
| Compound Name | N-(3-acetylphenyl)-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide |
|---|---|
| PubChem CID | 80518042 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-(3-acetylphenyl)-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CC2CS(=O)(=O)CCN2)c1 |
| InChI | InChI=1S/C14H18N2O4S/c1-10(17)11-3-2-4-12(7-11)16-14(18)8-13-9-21(19,20)6-5-15-13/h2-4,7,13,15H,5-6,8-9H2,1H3,(H,16,18) |
| InChIKey | ZRGBLZYJZZCEDD-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |