C13H17IN2O3S — CID 80519865
2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(3-iodo-4-methylphenyl)acetamide (PubChem CID 80519865) has the molecular formula C13H17IN2O3S and a molecular weight of 408.26 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(3-iodo-4-methylphenyl)acetamide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(3-iodo-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 80519865 |
| Molecular Formula | C13H17IN2O3S |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(3-iodo-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CC2CS(=O)(=O)CCN2)cc1I |
| InChI | InChI=1S/C13H17IN2O3S/c1-9-2-3-10(6-12(9)14)16-13(17)7-11-8-20(18,19)5-4-15-11/h2-3,6,11,15H,4-5,7-8H2,1H3,(H,16,17) |
| InChIKey | CKHMBJPIOYXHLN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|