C12H15IN2O3S — CID 80519811
2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(4-iodophenyl)acetamide (PubChem CID 80519811) has the molecular formula C12H15IN2O3S and a molecular weight of 394.23 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(4-iodophenyl)acetamide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 80519811 |
| Molecular Formula | C12H15IN2O3S |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(4-iodophenyl)acetamide |
| SMILES | O=C(CC1CS(=O)(=O)CCN1)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C12H15IN2O3S/c13-9-1-3-10(4-2-9)15-12(16)7-11-8-19(17,18)6-5-14-11/h1-4,11,14H,5-8H2,(H,15,16) |
| InChIKey | QYJMKVXOWMMALW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|