C14H17N3O3S — CID 80518373
2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(1H-indol-5-yl)acetamide (PubChem CID 80518373) has the molecular formula C14H17N3O3S and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(1H-indol-5-yl)acetamide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(1H-indol-5-yl)acetamide |
|---|---|
| PubChem CID | 80518373 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(1H-indol-5-yl)acetamide |
| SMILES | O=C(CC1CS(=O)(=O)CCN1)Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C14H17N3O3S/c18-14(8-12-9-21(19,20)6-5-15-12)17-11-1-2-13-10(7-11)3-4-16-13/h1-4,7,12,15-16H,5-6,8-9H2,(H,17,18) |
| InChIKey | RJIBJCPWESFCSP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |