C12H14Cl2N2O3S — CID 80520720
N-(2,6-dichlorophenyl)-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide (PubChem CID 80520720) has the molecular formula C12H14Cl2N2O3S and a molecular weight of 337.23 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide |
|---|---|
| PubChem CID | 80520720 |
| Molecular Formula | C12H14Cl2N2O3S |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide |
| SMILES | O=C(CC1CS(=O)(=O)CCN1)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H14Cl2N2O3S/c13-9-2-1-3-10(14)12(9)16-11(17)6-8-7-20(18,19)5-4-15-8/h1-3,8,15H,4-7H2,(H,16,17) |
| InChIKey | FEOBZKKHSGBZTR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |