C14H19ClN2O3S — CID 80518150
N-[1-(3-chlorophenyl)ethyl]-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide (PubChem CID 80518150) has the molecular formula C14H19ClN2O3S and a molecular weight of 330.84 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethyl]-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide.
| Compound Name | N-[1-(3-chlorophenyl)ethyl]-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide |
|---|---|
| PubChem CID | 80518150 |
| Molecular Formula | C14H19ClN2O3S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethyl]-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide |
| SMILES | CC(NC(=O)CC1CS(=O)(=O)CCN1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H19ClN2O3S/c1-10(11-3-2-4-12(15)7-11)17-14(18)8-13-9-21(19,20)6-5-16-13/h2-4,7,10,13,16H,5-6,8-9H2,1H3,(H,17,18) |
| InChIKey | YAZFBXNLYZBSDW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |