C12H14ClFN2O3S — CID 80519948
N-(2-chloro-4-fluorophenyl)-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide (PubChem CID 80519948) has the molecular formula C12H14ClFN2O3S and a molecular weight of 320.77 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide |
|---|---|
| PubChem CID | 80519948 |
| Molecular Formula | C12H14ClFN2O3S |
| Molecular Weight | 320.77 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide |
| SMILES | O=C(CC1CS(=O)(=O)CCN1)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C12H14ClFN2O3S/c13-10-5-8(14)1-2-11(10)16-12(17)6-9-7-20(18,19)4-3-15-9/h1-2,5,9,15H,3-4,6-7H2,(H,16,17) |
| InChIKey | FFHJDPWSSDJRLJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.77 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |