C13H15N3O3S2 — CID 107805198
N-(1,3-benzothiazol-6-yl)-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide (PubChem CID 107805198) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-yl)-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide.
| Compound Name | N-(1,3-benzothiazol-6-yl)-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide |
|---|---|
| PubChem CID | 107805198 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | N-(1,3-benzothiazol-6-yl)-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide |
| SMILES | O=C(CC1CS(=O)(=O)CCN1)Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C13H15N3O3S2/c17-13(6-10-7-21(18,19)4-3-14-10)16-9-1-2-11-12(5-9)20-8-15-11/h1-2,5,8,10,14H,3-4,6-7H2,(H,16,17) |
| InChIKey | QUBZEKDSJXHDQP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |