C14H17N3OS2 — CID 107805145
N-(1,3-benzothiazol-6-yl)-2-piperidin-4-ylsulfanylacetamide (PubChem CID 107805145) has the molecular formula C14H17N3OS2 and a molecular weight of 307.44 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-yl)-2-piperidin-4-ylsulfanylacetamide.
| Compound Name | N-(1,3-benzothiazol-6-yl)-2-piperidin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 107805145 |
| Molecular Formula | C14H17N3OS2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-(1,3-benzothiazol-6-yl)-2-piperidin-4-ylsulfanylacetamide |
| SMILES | O=C(CSC1CCNCC1)Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C14H17N3OS2/c18-14(8-19-11-3-5-15-6-4-11)17-10-1-2-12-13(7-10)20-9-16-12/h1-2,7,9,11,15H,3-6,8H2,(H,17,18) |
| InChIKey | VJDHUHXOWTXHHD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |