C13H17N3S — CID 107803941
N-(azepan-4-yl)-1,3-benzothiazol-6-amine (PubChem CID 107803941) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is N-(azepan-4-yl)-1,3-benzothiazol-6-amine.
| Compound Name | N-(azepan-4-yl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 107803941 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | N-(azepan-4-yl)-1,3-benzothiazol-6-amine |
| SMILES | c1nc2ccc(NC3CCCNCC3)cc2s1 |
| InChI | InChI=1S/C13H17N3S/c1-2-10(5-7-14-6-1)16-11-3-4-12-13(8-11)17-9-15-12/h3-4,8-10,14,16H,1-2,5-7H2 |
| InChIKey | ROLDOZHWYWWNSE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |