C13H17Cl2N3OS — CID 119427664
N-piperidin-3-yl-1,3-benzothiazole-6-carboxamide;dihydrochloride (PubChem CID 119427664) has the molecular formula C13H17Cl2N3OS and a molecular weight of 334.27 g/mol. Its IUPAC name is N-piperidin-3-yl-1,3-benzothiazole-6-carboxamide;dihydrochloride.
| Compound Name | N-piperidin-3-yl-1,3-benzothiazole-6-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119427664 |
| Molecular Formula | C13H17Cl2N3OS |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | N-piperidin-3-yl-1,3-benzothiazole-6-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NC1CCCNC1)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C13H15N3OS.2ClH/c17-13(16-10-2-1-5-14-7-10)9-3-4-11-12(6-9)18-8-15-11;;/h3-4,6,8,10,14H,1-2,5,7H2,(H,16,17);2*1H |
| InChIKey | FGIXFLLKIIDVSX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |