C14H19Cl2N3OS — CID 119477630
N-(4-aminocyclohexyl)-1,3-benzothiazole-6-carboxamide;dihydrochloride (PubChem CID 119477630) has the molecular formula C14H19Cl2N3OS and a molecular weight of 348.30 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-1,3-benzothiazole-6-carboxamide;dihydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-1,3-benzothiazole-6-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119477630 |
| Molecular Formula | C14H19Cl2N3OS |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N-(4-aminocyclohexyl)-1,3-benzothiazole-6-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC1CCC(NC(=O)c2ccc3ncsc3c2)CC1 |
| InChI | InChI=1S/C14H17N3OS.2ClH/c15-10-2-4-11(5-3-10)17-14(18)9-1-6-12-13(7-9)19-8-16-12;;/h1,6-8,10-11H,2-5,15H2,(H,17,18);2*1H |
| InChIKey | HDRZDQLGOVSIMS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |