C15H18N2S — CID 114227910
N-[(2E)-cyclooct-2-en-1-yl]-1,3-benzothiazol-6-amine (PubChem CID 114227910) has the molecular formula C15H18N2S and a molecular weight of 258.39 g/mol. Its IUPAC name is N-[(2E)-cyclooct-2-en-1-yl]-1,3-benzothiazol-6-amine.
| Compound Name | N-[(2E)-cyclooct-2-en-1-yl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 114227910 |
| Molecular Formula | C15H18N2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N-[(2E)-cyclooct-2-en-1-yl]-1,3-benzothiazol-6-amine |
| SMILES | C1=C\C(Nc2ccc3ncsc3c2)CCCCC/1 |
| InChI | InChI=1S/C15H18N2S/c1-2-4-6-12(7-5-3-1)17-13-8-9-14-15(10-13)18-11-16-14/h4,6,8-12,17H,1-3,5,7H2/b6-4- |
| InChIKey | RAYSBJPVEQJGCE-XQRVVYSFSA-N |
| XLogP | 4.60 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|