About 6-cycloheptyl-1,3-benzothiazole
6-cycloheptyl-1,3-benzothiazole (PubChem CID 173169792) has the molecular formula C14H17NS
and a molecular weight of 231.36 g/mol. Its IUPAC name is 6-cycloheptyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-cycloheptyl-1,3-benzothiazole |
| PubChem CID | 173169792 |
| Molecular Formula | C14H17NS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 6-cycloheptyl-1,3-benzothiazole |
| SMILES | c1nc2ccc(C3CCCCCC3)cc2s1 |
| InChI | InChI=1S/C14H17NS/c1-2-4-6-11(5-3-1)12-7-8-13-14(9-12)16-10-15-13/h7-11H,1-6H2 |
| InChIKey | AHFUOVICSOGASF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-cycloheptyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cycloheptyl-1,3-benzothiazole?
The IUPAC name of 6-cycloheptyl-1,3-benzothiazole (CID 173169792) is 6-cycloheptyl-1,3-benzothiazole.
What is the SMILES notation for 6-cycloheptyl-1,3-benzothiazole?
The canonical SMILES for 6-cycloheptyl-1,3-benzothiazole is c1nc2ccc(C3CCCCCC3)cc2s1.
What is the InChIKey of 6-cycloheptyl-1,3-benzothiazole?
The InChIKey is AHFUOVICSOGASF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NS/c1-2-4-6-11(5-3-1)12-7-8-13-14(9-12)16-10-15-13/h7-11H,1-6H2.
What are the key properties of 6-cycloheptyl-1,3-benzothiazole?
6-cycloheptyl-1,3-benzothiazole has a molecular weight of 231.36 g/mol, XLogP of 4.73, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cycloheptyl-1,3-benzothiazole is sourced from PubChem (CID 173169792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).