About benzene;1,3-benzothiazole;cyclohexane
benzene;1,3-benzothiazole;cyclohexane (PubChem CID 158485406) has the molecular formula C19H23NS
and a molecular weight of 297.47 g/mol. Its IUPAC name is benzene;1,3-benzothiazole;cyclohexane.
Molecular Properties
| Compound Name | benzene;1,3-benzothiazole;cyclohexane |
| PubChem CID | 158485406 |
| Molecular Formula | C19H23NS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | benzene;1,3-benzothiazole;cyclohexane |
| SMILES | C1CCCCC1.c1ccc2scnc2c1.c1ccccc1 |
| InChI | InChI=1S/C7H5NS.C6H12.C6H6/c1-2-4-7-6(3-1)8-5-9-7;2*1-2-4-6-5-3-1/h1-5H;1-6H2;1-6H |
| InChIKey | HIAOEQXMQOBCDV-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;1,3-benzothiazole;cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1,3-benzothiazole;cyclohexane?
The IUPAC name of benzene;1,3-benzothiazole;cyclohexane (CID 158485406) is benzene;1,3-benzothiazole;cyclohexane.
What is the SMILES notation for benzene;1,3-benzothiazole;cyclohexane?
The canonical SMILES for benzene;1,3-benzothiazole;cyclohexane is C1CCCCC1.c1ccc2scnc2c1.c1ccccc1.
What is the InChIKey of benzene;1,3-benzothiazole;cyclohexane?
The InChIKey is HIAOEQXMQOBCDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS.C6H12.C6H6/c1-2-4-7-6(3-1)8-5-9-7;2*1-2-4-6-5-3-1/h1-5H;1-6H2;1-6H.
What are the key properties of benzene;1,3-benzothiazole;cyclohexane?
benzene;1,3-benzothiazole;cyclohexane has a molecular weight of 297.47 g/mol, XLogP of 6.32, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1,3-benzothiazole;cyclohexane is sourced from PubChem (CID 158485406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).