About 1,3-benzothiazole;isothiocyanic acid
1,3-benzothiazole;isothiocyanic acid (PubChem CID 175251975) has the molecular formula C8H6N2S2
and a molecular weight of 194.28 g/mol. Its IUPAC name is 1,3-benzothiazole;isothiocyanic acid.
Molecular Properties
| Compound Name | 1,3-benzothiazole;isothiocyanic acid |
| PubChem CID | 175251975 |
| Molecular Formula | C8H6N2S2 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | 1,3-benzothiazole;isothiocyanic acid |
| SMILES | N=C=S.c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H5NS.CHNS/c1-2-4-7-6(3-1)8-5-9-7;2-1-3/h1-5H;2H |
| InChIKey | XJDOEHWHZGFFDM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 36.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-benzothiazole;isothiocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazole;isothiocyanic acid?
The IUPAC name of 1,3-benzothiazole;isothiocyanic acid (CID 175251975) is 1,3-benzothiazole;isothiocyanic acid.
What is the SMILES notation for 1,3-benzothiazole;isothiocyanic acid?
The canonical SMILES for 1,3-benzothiazole;isothiocyanic acid is N=C=S.c1ccc2scnc2c1.
What is the InChIKey of 1,3-benzothiazole;isothiocyanic acid?
The InChIKey is XJDOEHWHZGFFDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS.CHNS/c1-2-4-7-6(3-1)8-5-9-7;2-1-3/h1-5H;2H.
What are the key properties of 1,3-benzothiazole;isothiocyanic acid?
1,3-benzothiazole;isothiocyanic acid has a molecular weight of 194.28 g/mol, XLogP of 2.96, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazole;isothiocyanic acid is sourced from PubChem (CID 175251975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).