1,3-benzothiazole;isothiocyanic acid

C8H6N2S2 — CID 175251975

IUPAC1,3-benzothiazole;isothiocyanic acid
SMILESN=C=S.c1ccc2scnc2c1
InChIInChI=1S/C7H5NS.CHNS/c1-2-4-7-6(3-1)8-5-9-7;2-1-3/h1-5H;2H
InChIKeyXJDOEHWHZGFFDM-UHFFFAOYSA-N
MW194.28 g/mol
LogP2.96
Rot. Bonds

About 1,3-benzothiazole;isothiocyanic acid

1,3-benzothiazole;isothiocyanic acid (PubChem CID 175251975) has the molecular formula C8H6N2S2 and a molecular weight of 194.28 g/mol. Its IUPAC name is 1,3-benzothiazole;isothiocyanic acid.

Molecular Properties

Compound Name1,3-benzothiazole;isothiocyanic acid
PubChem CID175251975
Molecular FormulaC8H6N2S2
Molecular Weight194.28 g/mol
Exact Mass194.00
IUPAC Name1,3-benzothiazole;isothiocyanic acid
SMILESN=C=S.c1ccc2scnc2c1
InChIInChI=1S/C7H5NS.CHNS/c1-2-4-7-6(3-1)8-5-9-7;2-1-3/h1-5H;2H
InChIKeyXJDOEHWHZGFFDM-UHFFFAOYSA-N
XLogP2.96
TPSA36.74 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.28
LogP ≤ 52.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}

Analyze 1,3-benzothiazole;isothiocyanic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-benzothiazole;isothiocyanic acid?
The IUPAC name of 1,3-benzothiazole;isothiocyanic acid (CID 175251975) is 1,3-benzothiazole;isothiocyanic acid.
What is the SMILES notation for 1,3-benzothiazole;isothiocyanic acid?
The canonical SMILES for 1,3-benzothiazole;isothiocyanic acid is N=C=S.c1ccc2scnc2c1.
What is the InChIKey of 1,3-benzothiazole;isothiocyanic acid?
The InChIKey is XJDOEHWHZGFFDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS.CHNS/c1-2-4-7-6(3-1)8-5-9-7;2-1-3/h1-5H;2H.
What are the key properties of 1,3-benzothiazole;isothiocyanic acid?
1,3-benzothiazole;isothiocyanic acid has a molecular weight of 194.28 g/mol, XLogP of 2.96, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazole;isothiocyanic acid is sourced from PubChem (CID 175251975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).