C7H9NO8S3 — CID 174851582
1,3-benzothiazole;sulfuric acid (PubChem CID 174851582) has the molecular formula C7H9NO8S3 and a molecular weight of 331.35 g/mol. Its IUPAC name is 1,3-benzothiazole;sulfuric acid.
| Compound Name | 1,3-benzothiazole;sulfuric acid |
|---|---|
| PubChem CID | 174851582 |
| Molecular Formula | C7H9NO8S3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 330.95 |
| IUPAC Name | 1,3-benzothiazole;sulfuric acid |
| SMILES | O=S(=O)(O)O.O=S(=O)(O)O.c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H5NS.2H2O4S/c1-2-4-7-6(3-1)8-5-9-7;2*1-5(2,3)4/h1-5H;2*(H2,1,2,3,4) |
| InChIKey | MUKIAHUSBWAZRW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 162.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|