About 1,3-benzothiazole;sulfurous acid;hydrate
1,3-benzothiazole;sulfurous acid;hydrate (PubChem CID 70542963) has the molecular formula C7H9NO4S2
and a molecular weight of 235.29 g/mol. Its IUPAC name is 1,3-benzothiazole;sulfurous acid;hydrate.
Molecular Properties
| Compound Name | 1,3-benzothiazole;sulfurous acid;hydrate |
| PubChem CID | 70542963 |
| Molecular Formula | C7H9NO4S2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 1,3-benzothiazole;sulfurous acid;hydrate |
| SMILES | O.O=S(O)O.c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H5NS.H2O3S.H2O/c1-2-4-7-6(3-1)8-5-9-7;1-4(2)3;/h1-5H;(H2,1,2,3);1H2 |
| InChIKey | UONAFQDDPRLMOJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1,3-benzothiazole;sulfurous acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazole;sulfurous acid;hydrate?
The IUPAC name of 1,3-benzothiazole;sulfurous acid;hydrate (CID 70542963) is 1,3-benzothiazole;sulfurous acid;hydrate.
What is the SMILES notation for 1,3-benzothiazole;sulfurous acid;hydrate?
The canonical SMILES for 1,3-benzothiazole;sulfurous acid;hydrate is O.O=S(O)O.c1ccc2scnc2c1.
What is the InChIKey of 1,3-benzothiazole;sulfurous acid;hydrate?
The InChIKey is UONAFQDDPRLMOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS.H2O3S.H2O/c1-2-4-7-6(3-1)8-5-9-7;1-4(2)3;/h1-5H;(H2,1,2,3);1H2.
What are the key properties of 1,3-benzothiazole;sulfurous acid;hydrate?
1,3-benzothiazole;sulfurous acid;hydrate has a molecular weight of 235.29 g/mol, XLogP of 1.15, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazole;sulfurous acid;hydrate is sourced from PubChem (CID 70542963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).