About 1,3-benzothiazole;trihydrochloride
1,3-benzothiazole;trihydrochloride (PubChem CID 162189976) has the molecular formula C7H8Cl3NS
and a molecular weight of 244.57 g/mol. Its IUPAC name is 1,3-benzothiazole;trihydrochloride.
Molecular Properties
| Compound Name | 1,3-benzothiazole;trihydrochloride |
| PubChem CID | 162189976 |
| Molecular Formula | C7H8Cl3NS |
| Molecular Weight | 244.57 g/mol |
| Exact Mass | 242.94 |
| IUPAC Name | 1,3-benzothiazole;trihydrochloride |
| SMILES | Cl.Cl.Cl.c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H5NS.3ClH/c1-2-4-7-6(3-1)8-5-9-7;;;/h1-5H;3*1H |
| InChIKey | ZQDZHPXBCKMRKP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-benzothiazole;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazole;trihydrochloride?
The IUPAC name of 1,3-benzothiazole;trihydrochloride (CID 162189976) is 1,3-benzothiazole;trihydrochloride.
What is the SMILES notation for 1,3-benzothiazole;trihydrochloride?
The canonical SMILES for 1,3-benzothiazole;trihydrochloride is Cl.Cl.Cl.c1ccc2scnc2c1.
What is the InChIKey of 1,3-benzothiazole;trihydrochloride?
The InChIKey is ZQDZHPXBCKMRKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS.3ClH/c1-2-4-7-6(3-1)8-5-9-7;;;/h1-5H;3*1H.
What are the key properties of 1,3-benzothiazole;trihydrochloride?
1,3-benzothiazole;trihydrochloride has a molecular weight of 244.57 g/mol, XLogP of 3.56, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazole;trihydrochloride is sourced from PubChem (CID 162189976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).