About 1,3-benzothiazole;zinc
1,3-benzothiazole;zinc (PubChem CID 66588590) has the molecular formula C7H5NSZn
and a molecular weight of 200.58 g/mol. Its IUPAC name is 1,3-benzothiazole;zinc.
Molecular Properties
| Compound Name | 1,3-benzothiazole;zinc |
| PubChem CID | 66588590 |
| Molecular Formula | C7H5NSZn |
| Molecular Weight | 200.58 g/mol |
| Exact Mass | 198.94 |
| IUPAC Name | 1,3-benzothiazole;zinc |
| SMILES | [Zn].c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H5NS.Zn/c1-2-4-7-6(3-1)8-5-9-7;/h1-5H; |
| InChIKey | SHXCHSNZIGEBFL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.58 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,3-benzothiazole;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazole;zinc?
The IUPAC name of 1,3-benzothiazole;zinc (CID 66588590) is 1,3-benzothiazole;zinc.
What is the SMILES notation for 1,3-benzothiazole;zinc?
The canonical SMILES for 1,3-benzothiazole;zinc is [Zn].c1ccc2scnc2c1.
What is the InChIKey of 1,3-benzothiazole;zinc?
The InChIKey is SHXCHSNZIGEBFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS.Zn/c1-2-4-7-6(3-1)8-5-9-7;/h1-5H;.
What are the key properties of 1,3-benzothiazole;zinc?
1,3-benzothiazole;zinc has a molecular weight of 200.58 g/mol, XLogP of 2.29, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazole;zinc is sourced from PubChem (CID 66588590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).