About 1,3-benzothiazole;thiohydroxylamine
1,3-benzothiazole;thiohydroxylamine (PubChem CID 174771488) has the molecular formula C7H8N2S2
and a molecular weight of 184.29 g/mol. Its IUPAC name is 1,3-benzothiazole;thiohydroxylamine.
Molecular Properties
| Compound Name | 1,3-benzothiazole;thiohydroxylamine |
| PubChem CID | 174771488 |
| Molecular Formula | C7H8N2S2 |
| Molecular Weight | 184.29 g/mol |
| Exact Mass | 184.01 |
| IUPAC Name | 1,3-benzothiazole;thiohydroxylamine |
| SMILES | NS.c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H5NS.H3NS/c1-2-4-7-6(3-1)8-5-9-7;1-2/h1-5H;2H,1H2 |
| InChIKey | OWRSECPWXLIRLL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-benzothiazole;thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazole;thiohydroxylamine?
The IUPAC name of 1,3-benzothiazole;thiohydroxylamine (CID 174771488) is 1,3-benzothiazole;thiohydroxylamine.
What is the SMILES notation for 1,3-benzothiazole;thiohydroxylamine?
The canonical SMILES for 1,3-benzothiazole;thiohydroxylamine is NS.c1ccc2scnc2c1.
What is the InChIKey of 1,3-benzothiazole;thiohydroxylamine?
The InChIKey is OWRSECPWXLIRLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS.H3NS/c1-2-4-7-6(3-1)8-5-9-7;1-2/h1-5H;2H,1H2.
What are the key properties of 1,3-benzothiazole;thiohydroxylamine?
1,3-benzothiazole;thiohydroxylamine has a molecular weight of 184.29 g/mol, XLogP of 2.09, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazole;thiohydroxylamine is sourced from PubChem (CID 174771488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).