About 2-aminobenzenethiol;1,3-benzothiazole
2-aminobenzenethiol;1,3-benzothiazole (PubChem CID 176901024) has the molecular formula C13H12N2S2
and a molecular weight of 260.39 g/mol. Its IUPAC name is 2-aminobenzenethiol;1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-aminobenzenethiol;1,3-benzothiazole |
| PubChem CID | 176901024 |
| Molecular Formula | C13H12N2S2 |
| Molecular Weight | 260.39 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 2-aminobenzenethiol;1,3-benzothiazole |
| SMILES | Nc1ccccc1S.c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H5NS.C6H7NS/c1-2-4-7-6(3-1)8-5-9-7;7-5-3-1-2-4-6(5)8/h1-5H;1-4,8H,7H2 |
| InChIKey | NOFBAYGBQUQTKF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzenethiol;1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzenethiol;1,3-benzothiazole?
The IUPAC name of 2-aminobenzenethiol;1,3-benzothiazole (CID 176901024) is 2-aminobenzenethiol;1,3-benzothiazole.
What is the SMILES notation for 2-aminobenzenethiol;1,3-benzothiazole?
The canonical SMILES for 2-aminobenzenethiol;1,3-benzothiazole is Nc1ccccc1S.c1ccc2scnc2c1.
What is the InChIKey of 2-aminobenzenethiol;1,3-benzothiazole?
The InChIKey is NOFBAYGBQUQTKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS.C6H7NS/c1-2-4-7-6(3-1)8-5-9-7;7-5-3-1-2-4-6(5)8/h1-5H;1-4,8H,7H2.
What are the key properties of 2-aminobenzenethiol;1,3-benzothiazole?
2-aminobenzenethiol;1,3-benzothiazole has a molecular weight of 260.39 g/mol, XLogP of 3.85, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzenethiol;1,3-benzothiazole is sourced from PubChem (CID 176901024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).