About 1,3-benzothiazole;2-hydrazinylaniline
1,3-benzothiazole;2-hydrazinylaniline (PubChem CID 143333953) has the molecular formula C13H14N4S
and a molecular weight of 258.35 g/mol. Its IUPAC name is 1,3-benzothiazole;2-hydrazinylaniline.
Molecular Properties
| Compound Name | 1,3-benzothiazole;2-hydrazinylaniline |
| PubChem CID | 143333953 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 1,3-benzothiazole;2-hydrazinylaniline |
| SMILES | NNc1ccccc1N.c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H5NS.C6H9N3/c1-2-4-7-6(3-1)8-5-9-7;7-5-3-1-2-4-6(5)9-8/h1-5H;1-4,9H,7-8H2 |
| InChIKey | CTEGATWJOINMHG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-benzothiazole;2-hydrazinylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazole;2-hydrazinylaniline?
The IUPAC name of 1,3-benzothiazole;2-hydrazinylaniline (CID 143333953) is 1,3-benzothiazole;2-hydrazinylaniline.
What is the SMILES notation for 1,3-benzothiazole;2-hydrazinylaniline?
The canonical SMILES for 1,3-benzothiazole;2-hydrazinylaniline is NNc1ccccc1N.c1ccc2scnc2c1.
What is the InChIKey of 1,3-benzothiazole;2-hydrazinylaniline?
The InChIKey is CTEGATWJOINMHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS.C6H9N3/c1-2-4-7-6(3-1)8-5-9-7;7-5-3-1-2-4-6(5)9-8/h1-5H;1-4,9H,7-8H2.
What are the key properties of 1,3-benzothiazole;2-hydrazinylaniline?
1,3-benzothiazole;2-hydrazinylaniline has a molecular weight of 258.35 g/mol, XLogP of 2.85, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazole;2-hydrazinylaniline is sourced from PubChem (CID 143333953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).