C8H8N2OS — CID 160548939
1,3-benzothiazole;formamide (PubChem CID 160548939) has the molecular formula C8H8N2OS and a molecular weight of 180.23 g/mol. Its IUPAC name is 1,3-benzothiazole;formamide.
| Compound Name | 1,3-benzothiazole;formamide |
|---|---|
| PubChem CID | 160548939 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 1,3-benzothiazole;formamide |
| SMILES | NC=O.c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H5NS.CH3NO/c1-2-4-7-6(3-1)8-5-9-7;2-1-3/h1-5H;1H,(H2,2,3) |
| InChIKey | QXUNCBREMZZGLJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|