C11H9NO4S — CID 162315554
1,3-benzothiazole;(Z)-but-2-enedioic acid (PubChem CID 162315554) has the molecular formula C11H9NO4S and a molecular weight of 251.26 g/mol. Its IUPAC name is 1,3-benzothiazole;(Z)-but-2-enedioic acid.
| Compound Name | 1,3-benzothiazole;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 162315554 |
| Molecular Formula | C11H9NO4S |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 1,3-benzothiazole;(Z)-but-2-enedioic acid |
| SMILES | O=C(O)/C=C\C(=O)O.c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H5NS.C4H4O4/c1-2-4-7-6(3-1)8-5-9-7;5-3(6)1-2-4(7)8/h1-5H;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | RLJXMPJNFHBEMB-BTJKTKAUSA-N |
| XLogP | 2.01 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|