C11H11NO2S — CID 174918318
1,3-benzothiazole;2-methylprop-2-enoic acid (PubChem CID 174918318) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is 1,3-benzothiazole;2-methylprop-2-enoic acid.
| Compound Name | 1,3-benzothiazole;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 174918318 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 1,3-benzothiazole;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H5NS.C4H6O2/c1-2-4-7-6(3-1)8-5-9-7;1-3(2)4(5)6/h1-5H;1H2,2H3,(H,5,6) |
| InChIKey | ZMDQJOXXYHUFJW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|