C9H11NO2S — CID 158729735
1,3-benzothiazole;ethane-1,2-diol (PubChem CID 158729735) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is 1,3-benzothiazole;ethane-1,2-diol.
| Compound Name | 1,3-benzothiazole;ethane-1,2-diol |
|---|---|
| PubChem CID | 158729735 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 1,3-benzothiazole;ethane-1,2-diol |
| SMILES | OCCO.c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H5NS.C2H6O2/c1-2-4-7-6(3-1)8-5-9-7;3-1-2-4/h1-5H;3-4H,1-2H2 |
| InChIKey | IKYFIFKLCOZXAQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |