About 1,3-benzothiazole;2-sulfanylethanol
1,3-benzothiazole;2-sulfanylethanol (PubChem CID 175101345) has the molecular formula C9H11NOS2
and a molecular weight of 213.33 g/mol. Its IUPAC name is 1,3-benzothiazole;2-sulfanylethanol.
Molecular Properties
| Compound Name | 1,3-benzothiazole;2-sulfanylethanol |
| PubChem CID | 175101345 |
| Molecular Formula | C9H11NOS2 |
| Molecular Weight | 213.33 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | 1,3-benzothiazole;2-sulfanylethanol |
| SMILES | OCCS.c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H5NS.C2H6OS/c1-2-4-7-6(3-1)8-5-9-7;3-1-2-4/h1-5H;3-4H,1-2H2 |
| InChIKey | JJHXDNFIXJEGML-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-benzothiazole;2-sulfanylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazole;2-sulfanylethanol?
The IUPAC name of 1,3-benzothiazole;2-sulfanylethanol (CID 175101345) is 1,3-benzothiazole;2-sulfanylethanol.
What is the SMILES notation for 1,3-benzothiazole;2-sulfanylethanol?
The canonical SMILES for 1,3-benzothiazole;2-sulfanylethanol is OCCS.c1ccc2scnc2c1.
What is the InChIKey of 1,3-benzothiazole;2-sulfanylethanol?
The InChIKey is JJHXDNFIXJEGML-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS.C2H6OS/c1-2-4-7-6(3-1)8-5-9-7;3-1-2-4/h1-5H;3-4H,1-2H2.
What are the key properties of 1,3-benzothiazole;2-sulfanylethanol?
1,3-benzothiazole;2-sulfanylethanol has a molecular weight of 213.33 g/mol, XLogP of 2.20, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazole;2-sulfanylethanol is sourced from PubChem (CID 175101345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).