C10H13NO3S3 — CID 23448401
1,3-benzothiazole;3-sulfanylpropane-1-sulfonic acid (PubChem CID 23448401) has the molecular formula C10H13NO3S3 and a molecular weight of 291.42 g/mol. Its IUPAC name is 1,3-benzothiazole;3-sulfanylpropane-1-sulfonic acid.
| Compound Name | 1,3-benzothiazole;3-sulfanylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 23448401 |
| Molecular Formula | C10H13NO3S3 |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 1,3-benzothiazole;3-sulfanylpropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCS.c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H5NS.C3H8O3S2/c1-2-4-7-6(3-1)8-5-9-7;4-8(5,6)3-1-2-7/h1-5H;7H,1-3H2,(H,4,5,6) |
| InChIKey | XGGTZCNWCUXVME-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|