C10H11NO3S2 — CID 174703767
1,3-benzothiazole;prop-2-ene-1-sulfonic acid (PubChem CID 174703767) has the molecular formula C10H11NO3S2 and a molecular weight of 257.34 g/mol. Its IUPAC name is 1,3-benzothiazole;prop-2-ene-1-sulfonic acid.
| Compound Name | 1,3-benzothiazole;prop-2-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 174703767 |
| Molecular Formula | C10H11NO3S2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 1,3-benzothiazole;prop-2-ene-1-sulfonic acid |
| SMILES | C=CCS(=O)(=O)O.c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H5NS.C3H6O3S/c1-2-4-7-6(3-1)8-5-9-7;1-2-3-7(4,5)6/h1-5H;2H,1,3H2,(H,4,5,6) |
| InChIKey | XYYRJOWLWZWMJH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|