C16H25NS — CID 158733044
methane;6-methyl-1,3-benzothiazole;methylcyclohexane (PubChem CID 158733044) has the molecular formula C16H25NS and a molecular weight of 263.45 g/mol. Its IUPAC name is methane;6-methyl-1,3-benzothiazole;methylcyclohexane.
| Compound Name | methane;6-methyl-1,3-benzothiazole;methylcyclohexane |
|---|---|
| PubChem CID | 158733044 |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | methane;6-methyl-1,3-benzothiazole;methylcyclohexane |
| SMILES | C.CC1CCCCC1.Cc1ccc2ncsc2c1 |
| InChI | InChI=1S/C8H7NS.C7H14.CH4/c1-6-2-3-7-8(4-6)10-5-9-7;1-7-5-3-2-4-6-7;/h2-5H,1H3;7H,2-6H2,1H3;1H4 |
| InChIKey | ILIJMUIDGGKDDA-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |