C16H21N3S — CID 107806626
6-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1,3-benzothiazole (PubChem CID 107806626) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 6-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1,3-benzothiazole.
| Compound Name | 6-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 107806626 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 6-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1,3-benzothiazole |
| SMILES | CC1CN2CCCCC2CN1c1ccc2ncsc2c1 |
| InChI | InChI=1S/C16H21N3S/c1-12-9-18-7-3-2-4-14(18)10-19(12)13-5-6-15-16(8-13)20-11-17-15/h5-6,8,11-12,14H,2-4,7,9-10H2,1H3 |
| InChIKey | SVMGHSNIDILGTE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |