C16H23N3S — CID 107806691
6-(5-tert-butyl-2-methylpiperazin-1-yl)-1,3-benzothiazole (PubChem CID 107806691) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is 6-(5-tert-butyl-2-methylpiperazin-1-yl)-1,3-benzothiazole.
| Compound Name | 6-(5-tert-butyl-2-methylpiperazin-1-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 107806691 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 6-(5-tert-butyl-2-methylpiperazin-1-yl)-1,3-benzothiazole |
| SMILES | CC1CNC(C(C)(C)C)CN1c1ccc2ncsc2c1 |
| InChI | InChI=1S/C16H23N3S/c1-11-8-17-15(16(2,3)4)9-19(11)12-5-6-13-14(7-12)20-10-18-13/h5-7,10-11,15,17H,8-9H2,1-4H3 |
| InChIKey | APAKGFAENSGYDB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |