C9H7N5S — CID 107806802
2-(1,3-benzothiazol-6-yl)triazol-4-amine (PubChem CID 107806802) has the molecular formula C9H7N5S and a molecular weight of 217.26 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-6-yl)triazol-4-amine.
| Compound Name | 2-(1,3-benzothiazol-6-yl)triazol-4-amine |
|---|---|
| PubChem CID | 107806802 |
| Molecular Formula | C9H7N5S |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 2-(1,3-benzothiazol-6-yl)triazol-4-amine |
| SMILES | Nc1cnn(-c2ccc3ncsc3c2)n1 |
| InChI | InChI=1S/C9H7N5S/c10-9-4-12-14(13-9)6-1-2-7-8(3-6)15-5-11-7/h1-5H,(H2,10,13) |
| InChIKey | ZOXGFYACHIXRHW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |