C10H8N4OS — CID 96599066
5-amino-2-(1,3-benzothiazol-6-yl)-4H-pyrazol-3-one (PubChem CID 96599066) has the molecular formula C10H8N4OS and a molecular weight of 232.27 g/mol. Its IUPAC name is 5-amino-2-(1,3-benzothiazol-6-yl)-4H-pyrazol-3-one.
| Compound Name | 5-amino-2-(1,3-benzothiazol-6-yl)-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 96599066 |
| Molecular Formula | C10H8N4OS |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 5-amino-2-(1,3-benzothiazol-6-yl)-4H-pyrazol-3-one |
| SMILES | NC1=NN(c2ccc3ncsc3c2)C(=O)C1 |
| InChI | InChI=1S/C10H8N4OS/c11-9-4-10(15)14(13-9)6-1-2-7-8(3-6)16-5-12-7/h1-3,5H,4H2,(H2,11,13) |
| InChIKey | NEFUEWZZAMSOAN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |