C15H12N2OS — CID 107801156
1-(1,3-benzothiazol-6-yl)-6,7-dihydro-5H-indol-4-one (PubChem CID 107801156) has the molecular formula C15H12N2OS and a molecular weight of 268.34 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-6-yl)-6,7-dihydro-5H-indol-4-one.
| Compound Name | 1-(1,3-benzothiazol-6-yl)-6,7-dihydro-5H-indol-4-one |
|---|---|
| PubChem CID | 107801156 |
| Molecular Formula | C15H12N2OS |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 1-(1,3-benzothiazol-6-yl)-6,7-dihydro-5H-indol-4-one |
| SMILES | O=C1CCCc2c1ccn2-c1ccc2ncsc2c1 |
| InChI | InChI=1S/C15H12N2OS/c18-14-3-1-2-13-11(14)6-7-17(13)10-4-5-12-15(8-10)19-9-16-12/h4-9H,1-3H2 |
| InChIKey | AKTSHUBOVIAOMT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |