C14H15N3OS — CID 58811902
(2E)-2-(1,3-benzothiazol-6-ylhydrazinylidene)cycloheptan-1-one (PubChem CID 58811902) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is (2E)-2-(1,3-benzothiazol-6-ylhydrazinylidene)cycloheptan-1-one.
| Compound Name | (2E)-2-(1,3-benzothiazol-6-ylhydrazinylidene)cycloheptan-1-one |
|---|---|
| PubChem CID | 58811902 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | (2E)-2-(1,3-benzothiazol-6-ylhydrazinylidene)cycloheptan-1-one |
| SMILES | O=C1CCCCC/C1=N\Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C14H15N3OS/c18-13-5-3-1-2-4-11(13)17-16-10-6-7-12-14(8-10)19-9-15-12/h6-9,16H,1-5H2/b17-11+ |
| InChIKey | HUVOPXXQSQZKHB-GZTJUZNOSA-N |
| XLogP | 3.60 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|