About (2E)-2-(1,3-benzothiazol-6-ylhydrazinylidene)cycloheptan-1-one
(2E)-2-(1,3-benzothiazol-6-ylhydrazinylidene)cycloheptan-1-one (PubChem CID 58811902) has the molecular formula C14H15N3OS
and a molecular weight of 273.36 g/mol. Its IUPAC name is (2E)-2-(1,3-benzothiazol-6-ylhydrazinylidene)cycloheptan-1-one.
Molecular Properties
| Compound Name | (2E)-2-(1,3-benzothiazol-6-ylhydrazinylidene)cycloheptan-1-one |
| PubChem CID | 58811902 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | (2E)-2-(1,3-benzothiazol-6-ylhydrazinylidene)cycloheptan-1-one |
| SMILES | O=C1CCCCC/C1=N\Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C14H15N3OS/c18-13-5-3-1-2-4-11(13)17-16-10-6-7-12-14(8-10)19-9-15-12/h6-9,16H,1-5H2/b17-11+ |
| InChIKey | HUVOPXXQSQZKHB-GZTJUZNOSA-N |
| XLogP | 3.60 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(1,3-benzothiazol-6-ylhydrazinylidene)cycloheptan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(1,3-benzothiazol-6-ylhydrazinylidene)cycloheptan-1-one?
The IUPAC name of (2E)-2-(1,3-benzothiazol-6-ylhydrazinylidene)cycloheptan-1-one (CID 58811902) is (2E)-2-(1,3-benzothiazol-6-ylhydrazinylidene)cycloheptan-1-one.
What is the SMILES notation for (2E)-2-(1,3-benzothiazol-6-ylhydrazinylidene)cycloheptan-1-one?
The canonical SMILES for (2E)-2-(1,3-benzothiazol-6-ylhydrazinylidene)cycloheptan-1-one is O=C1CCCCC/C1=N\Nc1ccc2ncsc2c1.
What is the InChIKey of (2E)-2-(1,3-benzothiazol-6-ylhydrazinylidene)cycloheptan-1-one?
The InChIKey is HUVOPXXQSQZKHB-GZTJUZNOSA-N. The full InChI is InChI=1S/C14H15N3OS/c18-13-5-3-1-2-4-11(13)17-16-10-6-7-12-14(8-10)19-9-15-12/h6-9,16H,1-5H2/b17-11+.
What are the key properties of (2E)-2-(1,3-benzothiazol-6-ylhydrazinylidene)cycloheptan-1-one?
(2E)-2-(1,3-benzothiazol-6-ylhydrazinylidene)cycloheptan-1-one has a molecular weight of 273.36 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(1,3-benzothiazol-6-ylhydrazinylidene)cycloheptan-1-one is sourced from PubChem (CID 58811902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).