C11H9N3O2S — CID 107804200
3-(1,3-benzothiazol-6-ylamino)pyrrolidine-2,5-dione (PubChem CID 107804200) has the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-6-ylamino)pyrrolidine-2,5-dione.
| Compound Name | 3-(1,3-benzothiazol-6-ylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 107804200 |
| Molecular Formula | C11H9N3O2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 3-(1,3-benzothiazol-6-ylamino)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(Nc2ccc3ncsc3c2)C(=O)N1 |
| InChI | InChI=1S/C11H9N3O2S/c15-10-4-8(11(16)14-10)13-6-1-2-7-9(3-6)17-5-12-7/h1-3,5,8,13H,4H2,(H,14,15,16) |
| InChIKey | QEJUYLCQLTYHCI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|