C11H11ClN2O3 — CID 43637753
3-(3-chloro-4-methoxyanilino)pyrrolidine-2,5-dione (PubChem CID 43637753) has the molecular formula C11H11ClN2O3 and a molecular weight of 254.67 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyanilino)pyrrolidine-2,5-dione.
| Compound Name | 3-(3-chloro-4-methoxyanilino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43637753 |
| Molecular Formula | C11H11ClN2O3 |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 3-(3-chloro-4-methoxyanilino)pyrrolidine-2,5-dione |
| SMILES | COc1ccc(NC2CC(=O)NC2=O)cc1Cl |
| InChI | InChI=1S/C11H11ClN2O3/c1-17-9-3-2-6(4-7(9)12)13-8-5-10(15)14-11(8)16/h2-4,8,13H,5H2,1H3,(H,14,15,16) |
| InChIKey | MBKNKTWRPXISEW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|