C10H11N3O3 — CID 43637684
3-[(6-methoxy-3-pyridinyl)amino]pyrrolidine-2,5-dione (PubChem CID 43637684) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is 3-[(6-methoxy-3-pyridinyl)amino]pyrrolidine-2,5-dione.
| Compound Name | 3-[(6-methoxy-3-pyridinyl)amino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43637684 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 3-[(6-methoxy-3-pyridinyl)amino]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(NC2CC(=O)NC2=O)cn1 |
| InChI | InChI=1S/C10H11N3O3/c1-16-9-3-2-6(5-11-9)12-7-4-8(14)13-10(7)15/h2-3,5,7,12H,4H2,1H3,(H,13,14,15) |
| InChIKey | OSOMOAGBYMPAMZ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|