C13H21N3O — CID 114235295
N-(3,3-dimethylpiperidin-4-yl)-6-methoxypyridin-3-amine (PubChem CID 114235295) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is N-(3,3-dimethylpiperidin-4-yl)-6-methoxypyridin-3-amine.
| Compound Name | N-(3,3-dimethylpiperidin-4-yl)-6-methoxypyridin-3-amine |
|---|---|
| PubChem CID | 114235295 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | N-(3,3-dimethylpiperidin-4-yl)-6-methoxypyridin-3-amine |
| SMILES | COc1ccc(NC2CCNCC2(C)C)cn1 |
| InChI | InChI=1S/C13H21N3O/c1-13(2)9-14-7-6-11(13)16-10-4-5-12(17-3)15-8-10/h4-5,8,11,14,16H,6-7,9H2,1-3H3 |
| InChIKey | MHEKBEHTPOCQIE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |