C11H16N2OS — CID 79941406
6-methoxy-N-(5-methylthiolan-3-yl)pyridin-3-amine (PubChem CID 79941406) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 6-methoxy-N-(5-methylthiolan-3-yl)pyridin-3-amine.
| Compound Name | 6-methoxy-N-(5-methylthiolan-3-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 79941406 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 6-methoxy-N-(5-methylthiolan-3-yl)pyridin-3-amine |
| SMILES | COc1ccc(NC2CSC(C)C2)cn1 |
| InChI | InChI=1S/C11H16N2OS/c1-8-5-10(7-15-8)13-9-3-4-11(14-2)12-6-9/h3-4,6,8,10,13H,5,7H2,1-2H3 |
| InChIKey | ZFLOJVYJOJMDBC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |