C10H14N2O4S — CID 60884021
4-[(6-methoxy-3-pyridinyl)amino]-1,1-dioxothiolan-3-ol (PubChem CID 60884021) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 4-[(6-methoxy-3-pyridinyl)amino]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[(6-methoxy-3-pyridinyl)amino]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 60884021 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 4-[(6-methoxy-3-pyridinyl)amino]-1,1-dioxothiolan-3-ol |
| SMILES | COc1ccc(NC2CS(=O)(=O)CC2O)cn1 |
| InChI | InChI=1S/C10H14N2O4S/c1-16-10-3-2-7(4-11-10)12-8-5-17(14,15)6-9(8)13/h2-4,8-9,12-13H,5-6H2,1H3 |
| InChIKey | DGVIDYBCCSZXEI-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |