C7H12N2O7P2 — CID 11716344
[[(6-methoxy-3-pyridinyl)amino]-phosphonomethyl]phosphonic acid (PubChem CID 11716344) has the molecular formula C7H12N2O7P2 and a molecular weight of 298.13 g/mol. Its IUPAC name is [[(6-methoxy-3-pyridinyl)amino]-phosphonomethyl]phosphonic acid.
| Compound Name | [[(6-methoxy-3-pyridinyl)amino]-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 11716344 |
| Molecular Formula | C7H12N2O7P2 |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | [[(6-methoxy-3-pyridinyl)amino]-phosphonomethyl]phosphonic acid |
| SMILES | COc1ccc(NC(P(=O)(O)O)P(=O)(O)O)cn1 |
| InChI | InChI=1S/C7H12N2O7P2/c1-16-6-3-2-5(4-8-6)9-7(17(10,11)12)18(13,14)15/h2-4,7,9H,1H3,(H2,10,11,12)(H2,13,14,15) |
| InChIKey | DXEUCCLZPQHDSZ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|