C13H14N4O2 — CID 61090732
3,5-diamino-N-(6-methoxy-3-pyridinyl)benzamide (PubChem CID 61090732) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 3,5-diamino-N-(6-methoxy-3-pyridinyl)benzamide.
| Compound Name | 3,5-diamino-N-(6-methoxy-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 61090732 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 3,5-diamino-N-(6-methoxy-3-pyridinyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2cc(N)cc(N)c2)cn1 |
| InChI | InChI=1S/C13H14N4O2/c1-19-12-3-2-11(7-16-12)17-13(18)8-4-9(14)6-10(15)5-8/h2-7H,14-15H2,1H3,(H,17,18) |
| InChIKey | GFGHDUWRARIRSS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|