C15H17N3O4 — CID 11630852
2-amino-4,6-dimethoxy-N-(6-methoxy-3-pyridinyl)benzamide (PubChem CID 11630852) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-amino-4,6-dimethoxy-N-(6-methoxy-3-pyridinyl)benzamide.
| Compound Name | 2-amino-4,6-dimethoxy-N-(6-methoxy-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 11630852 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-amino-4,6-dimethoxy-N-(6-methoxy-3-pyridinyl)benzamide |
| SMILES | COc1cc(N)c(C(=O)Nc2ccc(OC)nc2)c(OC)c1 |
| InChI | InChI=1S/C15H17N3O4/c1-20-10-6-11(16)14(12(7-10)21-2)15(19)18-9-4-5-13(22-3)17-8-9/h4-8H,16H2,1-3H3,(H,18,19) |
| InChIKey | MBVZANYTAQHOLC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|